cas: 101-85-9 — see every product listed under this CAS number, including other names
2-Benzylideneheptan-1-ol, 98% (CAS 101-85-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A209507-1g |
| cas | 101-85-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 395.50 Pln | |
| AmBeed | 5g | 1046.50 Pln | |
| AmBeed | 25g | 2999.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2Z)-2-benzylideneheptan-1-ol (CAS 101-85-9) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: (2Z)-2-benzylideneheptan-1-ol. InChIKey: LIPHCKNQPJXUQF-KAMYIIQDSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (2Z)-2-benzylideneheptan-1-ol |
| InChIKey | LIPHCKNQPJXUQF-KAMYIIQDSA-N |
| SMILES | CCCCC/C(=C/C1=CC=CC=C1)/CO |
Computed by PubChem (NCBI)