cas: 22047-88-7 — see every product listed under this CAS number, including other names
2-Benzyloxyphenylacetic acid, 98% (CAS 22047-88-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018225-250MG |
| cas | 22047-88-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1231.88 Pln | |
| Fluorochem | 10g | 2070.12 Pln | |
| Fluorochem | 25g | 4282.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-phenylmethoxyphenyl)acetic acid (CAS 22047-88-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(2-phenylmethoxyphenyl)acetic acid. InChIKey: VFYKRBZHJFJOGQ-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(2-phenylmethoxyphenyl)acetic acid |
| InChIKey | VFYKRBZHJFJOGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2CC(=O)O |
Computed by PubChem (NCBI)