Products 22047-88-7
CAS 22047-88-7 appears in our catalog under these names: [2-(benzyloxy)phenyl]acetic acid, 98%, 2-Phenylmethoxybenzeneacetic Acid, 2–(2–(Benzyloxy)phenyl)acetic acid, 2-Benzyloxyphenylacetic acid/ 98+%, (2-Benzyloxyphenyl)acetic acid. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Biosynth. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 2g, 500mg, 25g.
2-(2-phenylmethoxyphenyl)acetic acid (CAS 22047-88-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(2-phenylmethoxyphenyl)acetic acid. InChIKey: VFYKRBZHJFJOGQ-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(2-phenylmethoxyphenyl)acetic acid |
| InChIKey | VFYKRBZHJFJOGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-benzyloxyphenyl)acetic acid, 2-Benzyloxyphenylacetic acid, 2-(2-(benzyloxy)phenyl)acetic acid, 2-(2-phenylmethoxyphenyl)acetic acid, O-Benzyloxyphenylacetic acid, 2-Phenylmethoxybenzeneacetic Acid, [2-(benzyloxy)phenyl]acetic acid, 2-[2-(benzyloxy)phenyl]acetic acid, 2-(benzyloxy)phenylacetic acid, 2-(2-Benzyloxyphenyl)acetic acid