cas: 860436-57-3 — see every product listed under this CAS number, including other names
2-Boc-6-methoxy-1,2,3,4-tetrahydroisoquinoline, 95+% (CAS 860436-57-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A102333-100mg |
| cas | 860436-57-3 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1124.62 Pln | |
| AmBeed | 10g | 14645.89 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 860436-57-3) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: LQLAKQZVCKYEQC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | LQLAKQZVCKYEQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)OC |
Computed by PubChem (NCBI)