2-Bromo-1,1,2-triphenylethylene, 98%
cas: 1607-57-4 — see every product listed under this CAS number, including other names
2-Bromo-1,1,2-triphenylethylene, 98% (CAS 1607-57-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A555106-5g |
| cas | 1607-57-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 587.31 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 500g | 1790.40 Pln | |
| Chemat | 1kg | 3064.40 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 242.16 Pln | |
| BLDpharm | 100g | 630.91 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(1-bromo-2,2-diphenylethenyl)benzene (CAS 1607-57-4) is a chemical compound with the molecular formula C20H15Br and a molecular weight of 335.2 g/mol. IUPAC name: (1-bromo-2,2-diphenylethenyl)benzene. InChIKey: VUQVJIUBUPPCDB-UHFFFAOYSA-N.
| Molecular formula | C20H15Br |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | (1-bromo-2,2-diphenylethenyl)benzene |
| InChIKey | VUQVJIUBUPPCDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Bromotriphenylethylene, Triphenylethylene bromide, Phenylstilbene bromide, Benzene, 1,1',1''-(1-bromo-1-ethenyl-2-ylidene)tris-, 1-Bromo-1,2,2-triphenylethene, 1-bromo-1,2,2-triphenylethylene, 2-Bromo-1,1,2-triphenylethylene, (2-Bromoethene-1,1,2-triyl)tribenzene, Eitriphin, (1-bromo-2,2-diphenylethenyl)benzene