CAS 18648-66-3 appears in our catalog under these names: 2–(4–Bromophenyl)–1,1–diphenylethylene, 2-(4-Bromophenyl)-1,1-diphenylethylene 95%, 2-(4-Bromophenyl)-1,1-diphenylethylene, 95%, 95%, 2-(4-Bromophenyl)-1,1-diphenylethylene, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
1-bromo-4-(2,2-diphenylethenyl)benzene (CAS 18648-66-3) is a chemical compound with the molecular formula C20H15Br and a molecular weight of 335.2 g/mol. IUPAC name: 1-bromo-4-(2,2-diphenylethenyl)benzene. InChIKey: HUCFDUOIMSRYAA-UHFFFAOYSA-N.
| Molecular formula | C20H15Br |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 1-bromo-4-(2,2-diphenylethenyl)benzene |
| InChIKey | HUCFDUOIMSRYAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC2=CC=C(C=C2)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)