CAS 2249965-87-3 is the registry number for 9-(4-Bromophenyl)-9-methyl-9H-fluorene, 99.9%, 99.9%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g.
9-(4-bromophenyl)-9-methylfluorene (CAS 2249965-87-3) is a chemical compound with the molecular formula C20H15Br and a molecular weight of 335.2 g/mol. IUPAC name: 9-(4-bromophenyl)-9-methylfluorene. InChIKey: QRECDLYEORHLSV-UHFFFAOYSA-N.
| Molecular formula | C20H15Br |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 9-(4-bromophenyl)-9-methylfluorene |
| InChIKey | QRECDLYEORHLSV-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)