Products 762297-93-8
CAS 762297-93-8 is the registry number for 2-Bromo-1,3,5-trifluoro-4-nitrobenzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-bromo-1,3,5-trifluoro-4-nitrobenzene (CAS 762297-93-8) is a chemical compound with the molecular formula C6HBrF3NO2 and a molecular weight of 255.98 g/mol. IUPAC name: 2-bromo-1,3,5-trifluoro-4-nitrobenzene. InChIKey: SYTFXOAIAHTGBO-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3NO2 |
|---|---|
| Molecular weight | 255.98 g/mol |
| IUPAC name | 2-bromo-1,3,5-trifluoro-4-nitrobenzene |
| InChIKey | SYTFXOAIAHTGBO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)