2-Bromo-1,3,5-trifluoro-4-nitrobenzene, 97%
cas: 762297-93-8 — see every product listed under this CAS number, including other names
2-Bromo-1,3,5-trifluoro-4-nitrobenzene, 97% (CAS 762297-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A656245-100mg |
| cas | 762297-93-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 5727.06 Pln | |
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2536.40 Pln | |
| Chemat | 5g | 9957.20 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 564.27 Pln | |
| BLDpharm | 1g | 1591.69 Pln | |
| BLDpharm | 5g | 6167.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-1,3,5-trifluoro-4-nitrobenzene (CAS 762297-93-8) is a chemical compound with the molecular formula C6HBrF3NO2 and a molecular weight of 255.98 g/mol. IUPAC name: 2-bromo-1,3,5-trifluoro-4-nitrobenzene. InChIKey: SYTFXOAIAHTGBO-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3NO2 |
|---|---|
| Molecular weight | 255.98 g/mol |
| IUPAC name | 2-bromo-1,3,5-trifluoro-4-nitrobenzene |
| InChIKey | SYTFXOAIAHTGBO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)