CAS 1858250-22-2 is the registry number for 1-Bromo-2,3,4-trifluoro-5-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2,3,4-trifluoro-5-nitrobenzene (CAS 1858250-22-2) is a chemical compound with the molecular formula C6HBrF3NO2 and a molecular weight of 255.98 g/mol. IUPAC name: 1-bromo-2,3,4-trifluoro-5-nitrobenzene. InChIKey: ALMXOYIEKYSHHF-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3NO2 |
|---|---|
| Molecular weight | 255.98 g/mol |
| IUPAC name | 1-bromo-2,3,4-trifluoro-5-nitrobenzene |
| InChIKey | ALMXOYIEKYSHHF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)