CAS 1020718-01-7 is the registry number for 2-Bromo-3,4,5-trifluoro-1-nitrobenzene, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
4-bromo-1,2,3-trifluoro-5-nitrobenzene (CAS 1020718-01-7) is a chemical compound with the molecular formula C6HBrF3NO2 and a molecular weight of 255.98 g/mol. IUPAC name: 4-bromo-1,2,3-trifluoro-5-nitrobenzene. InChIKey: RISQAVRTASTTPY-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3NO2 |
|---|---|
| Molecular weight | 255.98 g/mol |
| IUPAC name | 4-bromo-1,2,3-trifluoro-5-nitrobenzene |
| InChIKey | RISQAVRTASTTPY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)