cas: 21524-34-5 — see every product listed under this CAS number, including other names
2-Bromo-1,3,5-triisopropylbenzene, 97% (CAS 21524-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g, 5g, 25g, 500g, 1kg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11497M-100g |
| cas | 21524-34-5 |
| size | 100g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 198.80 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 242.64 Pln | |
| Fluorochem | 500g | 961.14 Pln | |
| Fluorochem | 1kg | 1762.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1,3,5-tri(propan-2-yl)benzene (CAS 21524-34-5) is a chemical compound with the molecular formula C15H23Br and a molecular weight of 283.25 g/mol. IUPAC name: 2-bromo-1,3,5-tri(propan-2-yl)benzene. InChIKey: FUMMYHVKFAHQST-UHFFFAOYSA-N.
| Molecular formula | C15H23Br |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-bromo-1,3,5-tri(propan-2-yl)benzene |
| InChIKey | FUMMYHVKFAHQST-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)Br)C(C)C |
Computed by PubChem (NCBI)