CAS 62938-08-3 appears in our catalog under these names: 3,5–Di–tert–butylbenzyl bromide, 3,5-Di-tert-butylbenzyl Bromide, >98.0%(GC), 1-(Bromomethyl)-3,5-di-tert-butylbenzene 98%, 3,5-DI-TERT-BUTYLBENZYL BROMIDE, 97%, 1-(Bromomethyl)-3,5-di-tert-butylbenzene, 95%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 100mg, 250mg, 500g, 10g.
1-(bromomethyl)-3,5-ditert-butylbenzene (CAS 62938-08-3) is a chemical compound with the molecular formula C15H23Br and a molecular weight of 283.25 g/mol. IUPAC name: 1-(bromomethyl)-3,5-ditert-butylbenzene. InChIKey: SNRYBGHMHAJTTM-UHFFFAOYSA-N.
| Molecular formula | C15H23Br |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 1-(bromomethyl)-3,5-ditert-butylbenzene |
| InChIKey | SNRYBGHMHAJTTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)CBr)C(C)(C)C |
Computed by PubChem (NCBI)