CAS 21524-34-5 appears in our catalog under these names: 2–Bromo–1,3,5–triisopropylbenzene, 2-Bromo-1,3,5-triisopropylbenzene, 96% , 2-Bromo-1,3,5-triisopropylbenzene, 2-Bromo-1,3,5-triisopropylbenzene, >95.0%(GC), 2-Bromo-1,3,5-triisopropylbenzene 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 500g, 25g, 0,05kg, 0,1kg, 5g, 0,25kg, 10g.
2-bromo-1,3,5-tri(propan-2-yl)benzene (CAS 21524-34-5) is a chemical compound with the molecular formula C15H23Br and a molecular weight of 283.25 g/mol. IUPAC name: 2-bromo-1,3,5-tri(propan-2-yl)benzene. InChIKey: FUMMYHVKFAHQST-UHFFFAOYSA-N.
| Molecular formula | C15H23Br |
|---|---|
| Molecular weight | 283.25 g/mol |
| IUPAC name | 2-bromo-1,3,5-tri(propan-2-yl)benzene |
| InChIKey | FUMMYHVKFAHQST-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)Br)C(C)C |
Computed by PubChem (NCBI)