2-Bromo-1,4-difluoro-3-nitrobenzene, 95%
cas: 1804402-94-5 — see every product listed under this CAS number, including other names
2-Bromo-1,4-difluoro-3-nitrobenzene, 95% (CAS 1804402-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A286289-250mg |
| cas | 1804402-94-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1165.81 Pln | |
| Ambeed | 1g | 3023.69 Pln | |
| Ambeed | 5g | 10399.56 Pln | |
| BLDpharm | 100mg | 703.11 Pln | |
| BLDpharm | 250mg | 1141.84 Pln | |
| BLDpharm | 1g | 2963.43 Pln | |
| BLDpharm | 5g | 10199.77 Pln | |
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 2939.60 Pln | |
| Chemat | 5g | 10125.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-1,4-difluoro-3-nitrobenzene (CAS 1804402-94-5) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 2-bromo-1,4-difluoro-3-nitrobenzene. InChIKey: RIUSQZYGBQQWAF-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 2-bromo-1,4-difluoro-3-nitrobenzene |
| InChIKey | RIUSQZYGBQQWAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)