cas: 28179-33-1 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-phenoxyphenyl)ethanone 97% (CAS 28179-33-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A568649-5g |
| cas | 28179-33-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 22403.44 Pln | |
| Ambeed | 100mg | 1032.31 Pln | |
| Ambeed | 250mg | 1705.38 Pln | |
| Ambeed | 1g | 5654.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A568649 |
2-bromo-1-(4-phenoxyphenyl)ethanone (CAS 28179-33-1) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 2-bromo-1-(4-phenoxyphenyl)ethanone. InChIKey: RAXTYMXDSNWNJS-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-bromo-1-(4-phenoxyphenyl)ethanone |
| InChIKey | RAXTYMXDSNWNJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)