cas: 35081-45-9 — see every product listed under this CAS number, including other names
2-Bromo-1-[4-(phenylmethoxy)phenyl]-1-propanone, 98%, 98% (CAS 35081-45-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7Y1-5g |
| cas | 35081-45-9 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 198.80 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 250g | 405.20 Pln | |
| Chemat | 500g | 720.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(4-phenylmethoxyphenyl)propan-1-one (CAS 35081-45-9) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 2-bromo-1-(4-phenylmethoxyphenyl)propan-1-one. InChIKey: LSQLSCUJBXFBRB-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 2-bromo-1-(4-phenylmethoxyphenyl)propan-1-one |
| InChIKey | LSQLSCUJBXFBRB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)