CAS 1673515-05-3 is the registry number for 6-(5-Bromo-2-methyl-benzyl)-2,3-dihydro-benzo[1,4]dioxine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-[(5-bromo-2-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine (CAS 1673515-05-3) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 6-[(5-bromo-2-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine. InChIKey: VNYUECFPIATHSN-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 6-[(5-bromo-2-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| InChIKey | VNYUECFPIATHSN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)CC2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)