Products 37742-98-6
CAS 37742-98-6 appears in our catalog under these names: 4-Bromo-2,2-diphenylbutyric acid, 98%, 4-Bromo-2,2-diphenylbutanoic acid, 98%, 4-Bromo-2,2-diphenylbutyric Acid, 4–Bromo–2，2–diphenylbutyric Acid, 4-Bromo-2,2-diphenylbutyric Acid, >98.0%(T). Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 2,5g, 2g.
4-bromo-2,2-diphenylbutanoic acid (CAS 37742-98-6) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: 4-bromo-2,2-diphenylbutanoic acid. InChIKey: GFIYIIRFIODLLU-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | 4-bromo-2,2-diphenylbutanoic acid |
| InChIKey | GFIYIIRFIODLLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCBr)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)