cas: 1481-21-6 — see every product listed under this CAS number, including other names
2-Bromo-3,4,6-trifluoroaniline 99% (CAS 1481-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A698664-1g |
| cas | 1481-21-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A698664 |
2-bromo-3,4,6-trifluoroaniline (CAS 1481-21-6) is a chemical compound with the molecular formula C6H3BrF3N and a molecular weight of 225.99 g/mol. IUPAC name: 2-bromo-3,4,6-trifluoroaniline. InChIKey: MRXOTDULAFLMDA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3N |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 2-bromo-3,4,6-trifluoroaniline |
| InChIKey | MRXOTDULAFLMDA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)N)F |
Computed by PubChem (NCBI)