cas: 1481-21-6 — see every product listed under this CAS number, including other names
2-Bromo-3,4,6-trifluoroaniline, 98%, 98% (CAS 1481-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112FFQ-100mg |
| cas | 1481-21-6 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 803.60 Pln | |
| Chemat | 50g | 1432.40 Pln | |
| Chemat | 100g | 2349.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3,4,6-trifluoroaniline (CAS 1481-21-6) is a chemical compound with the molecular formula C6H3BrF3N and a molecular weight of 225.99 g/mol. IUPAC name: 2-bromo-3,4,6-trifluoroaniline. InChIKey: MRXOTDULAFLMDA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3N |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 2-bromo-3,4,6-trifluoroaniline |
| InChIKey | MRXOTDULAFLMDA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)N)F |
Computed by PubChem (NCBI)