CAS 101421-62-9 is the registry number for 2-Bromo-3,4-dimethyl-1-nitrobenzene, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-1,2-dimethyl-4-nitrobenzene (CAS 101421-62-9) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 3-bromo-1,2-dimethyl-4-nitrobenzene. InChIKey: NTKIHVHEUWEYCW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 3-bromo-1,2-dimethyl-4-nitrobenzene |
| InChIKey | NTKIHVHEUWEYCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])Br)C |
Computed by PubChem (NCBI)