cas: 1206978-11-1 — see every product listed under this CAS number, including other names
2-Bromo-3-(trifluoromethoxy)pyridine, 95%, 95% (CAS 1206978-11-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U45-50mg |
| cas | 1206978-11-1 |
| size | 50mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 410.00 Pln | |
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 952.40 Pln | |
| Chemat | 500mg | 1845.20 Pln | |
| Chemat | 1g | 2109.20 Pln | |
| Chemat | 5g | 6237.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3-(trifluoromethoxy)pyridine (CAS 1206978-11-1) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 2-bromo-3-(trifluoromethoxy)pyridine. InChIKey: BHUNBMCBYFTPAL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 2-bromo-3-(trifluoromethoxy)pyridine |
| InChIKey | BHUNBMCBYFTPAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)