CAS 1227494-05-4 appears in our catalog under these names: 4–Bromo–5–(trifluoromethyl)pyridin–2–ol, 4-Bromo-5-(trifluoromethyl)pyridin-2-ol, 95%, 4-Bromo-5-(trifluoromethyl)pyridin-2-ol 95%, 4-Bromo-5-(trifluoromethyl)pyridin-2-ol, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg.
4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 1227494-05-4) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: SDZLGVPGAFSPAM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 4-bromo-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | SDZLGVPGAFSPAM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CNC1=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)