Products 1211526-50-9
CAS 1211526-50-9 appears in our catalog under these names: 2-Bromo-6-(trifluoromethyl)pyridin-3-ol, 95%, 2-Bromo-6-(trifluoromethyl)-3-pyridinol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-6-(trifluoromethyl)pyridin-3-ol (CAS 1211526-50-9) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)pyridin-3-ol. InChIKey: HMOAJSVNWQZSAL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)pyridin-3-ol |
| InChIKey | HMOAJSVNWQZSAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)Br)C(F)(F)F |
Computed by PubChem (NCBI)