cas: 1805519-05-4 — see every product listed under this CAS number, including other names
2-Bromo-3-chloro-4-methyl-5-nitropyridine 95% (CAS 1805519-05-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116573-250mg |
| cas | 1805519-05-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 859.88 Pln | |
| Ambeed | 5g | 3963.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116573 |
2-bromo-3-chloro-4-methyl-5-nitropyridine (CAS 1805519-05-4) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 2-bromo-3-chloro-4-methyl-5-nitropyridine. InChIKey: RSGXPPFPPGSPOR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 2-bromo-3-chloro-4-methyl-5-nitropyridine |
| InChIKey | RSGXPPFPPGSPOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)