Products 2010955-37-8

CAS 2010955-37-8 is the registry number for 6-Amino-5-bromo-3-chloropyridine-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-amino-5-bromo-3-chloropyridine-2-carboxylic acid (CAS 2010955-37-8) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 6-amino-5-bromo-3-chloropyridine-2-carboxylic acid. InChIKey: QYXCAQRTYHVEOO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrClN2O2
Molecular weight251.46 g/mol
IUPAC name6-amino-5-bromo-3-chloropyridine-2-carboxylic acid
InChIKeyQYXCAQRTYHVEOO-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=C1Br)N)C(=O)O)Cl

Computed by PubChem (NCBI)