Products 1934490-90-0

CAS 1934490-90-0 is the registry number for 3-Amino-6-bromo-2-chloroisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-amino-6-bromo-2-chloropyridine-4-carboxylic acid (CAS 1934490-90-0) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 3-amino-6-bromo-2-chloropyridine-4-carboxylic acid. InChIKey: FDLOZVNTIKTCGM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrClN2O2
Molecular weight251.46 g/mol
IUPAC name3-amino-6-bromo-2-chloropyridine-4-carboxylic acid
InChIKeyFDLOZVNTIKTCGM-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=C1Br)Cl)N)C(=O)O

Computed by PubChem (NCBI)