cas: 384-16-7 — see every product listed under this CAS number, including other names
2-Bromo-3-chlorobenzotrifluoride, 97% (CAS 384-16-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034787-1G |
| cas | 384-16-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 341.56 Pln | |
| Fluorochem | 25g | 758.08 Pln | |
| Fluorochem | 100g | 2871.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-1-chloro-3-(trifluoromethyl)benzene (CAS 384-16-7) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 2-bromo-1-chloro-3-(trifluoromethyl)benzene. InChIKey: GMUWNTUONIQRFP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 2-bromo-1-chloro-3-(trifluoromethyl)benzene |
| InChIKey | GMUWNTUONIQRFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)