cas: 731817-89-3 — see every product listed under this CAS number, including other names
2-Bromo-3-fluorophenylboronic acid, 98%, 98% (CAS 731817-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IM3F-100mg |
| cas | 731817-89-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 1970.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-3-fluorophenyl)boronic acid (CAS 731817-89-3) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-3-fluorophenyl)boronic acid. InChIKey: WSTBHBDRGFAJCK-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-3-fluorophenyl)boronic acid |
| InChIKey | WSTBHBDRGFAJCK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)Br)(O)O |
Computed by PubChem (NCBI)