Products 731817-89-3
CAS 731817-89-3 appears in our catalog under these names: 2-Bromo-3-fluorobenzeneboronic acid, 98%, (2-Bromo-3-fluorophenyl)boronic acid, 95%, (2-Bromo-3-fluorophenyl)boronic acid 98%, 2-Bromo-3-fluorophenylboronic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2-bromo-3-fluorophenyl)boronic acid (CAS 731817-89-3) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-3-fluorophenyl)boronic acid. InChIKey: WSTBHBDRGFAJCK-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-3-fluorophenyl)boronic acid |
| InChIKey | WSTBHBDRGFAJCK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)Br)(O)O |
Computed by PubChem (NCBI)