CAS 1217501-12-6 appears in our catalog under these names: 2-Bromo-4-fluorophenylboronic acid, 98%, (2-Bromo-4-fluorophenyl)boronic acid, 98%, 98%, (2-Bromo-4-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 100mg, 250mg, 10g.
(2-bromo-4-fluorophenyl)boronic acid (CAS 1217501-12-6) is a chemical compound with the molecular formula C6H5BBrFO2 and a molecular weight of 218.82 g/mol. IUPAC name: (2-bromo-4-fluorophenyl)boronic acid. InChIKey: BHXVZYJULSWULU-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrFO2 |
|---|---|
| Molecular weight | 218.82 g/mol |
| IUPAC name | (2-bromo-4-fluorophenyl)boronic acid |
| InChIKey | BHXVZYJULSWULU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)Br)(O)O |
Computed by PubChem (NCBI)