Products 81569-33-7
CAS 81569-33-7 appears in our catalog under these names: 2-Bromo-4-(tert-butyl)thiazole-5-carboxylic acid, 95%, 95%, 2-Bromo-4-(tert-butyl)thiazole-5-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-tert-butyl-1,3-thiazole-5-carboxylic acid (CAS 81569-33-7) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1,3-thiazole-5-carboxylic acid. InChIKey: IASBPYACZUHGFQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | IASBPYACZUHGFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(SC(=N1)Br)C(=O)O |
Computed by PubChem (NCBI)