CAS 923148-87-2 appears in our catalog under these names: N-Methyl 4-bromo-3-methylbenzenesulfonamide, 96%, N-Methyl 4-bromo-3-methylbenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
4-bromo-N,3-dimethylbenzenesulfonamide (CAS 923148-87-2) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 4-bromo-N,3-dimethylbenzenesulfonamide. InChIKey: VKXILHHKRMMVQB-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 4-bromo-N,3-dimethylbenzenesulfonamide |
| InChIKey | VKXILHHKRMMVQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)NC)Br |
Computed by PubChem (NCBI)