CAS 204850-96-4 appears in our catalog under these names: 5-Bromo-n,2-dimethylbenzene-1-sulfonamide, 95%, 5-Bromo-N,2-dimethylbenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
5-bromo-N,2-dimethylbenzenesulfonamide (CAS 204850-96-4) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 5-bromo-N,2-dimethylbenzenesulfonamide. InChIKey: SGSUJQYIGUWVGW-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 5-bromo-N,2-dimethylbenzenesulfonamide |
| InChIKey | SGSUJQYIGUWVGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)S(=O)(=O)NC |
Computed by PubChem (NCBI)