cas: 929095-68-1 — see every product listed under this CAS number, including other names
2-Bromo-4-[(4-methoxyphenyl)methoxy]-1-nitro-benzene, 97% (CAS 929095-68-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624880-100MG |
| cas | 929095-68-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 500mg | 1382.86 Pln | |
| Fluorochem | 1g | 2044.09 Pln | |
| Fluorochem | 5g | 5985.41 Pln | |
| Fluorochem | 10g | 9921.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-[(4-methoxyphenyl)methoxy]-1-nitrobenzene (CAS 929095-68-1) is a chemical compound with the molecular formula C14H12BrNO4 and a molecular weight of 338.15 g/mol. IUPAC name: 2-bromo-4-[(4-methoxyphenyl)methoxy]-1-nitrobenzene. InChIKey: GUDZGDDGZLKVBN-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO4 |
|---|---|
| Molecular weight | 338.15 g/mol |
| IUPAC name | 2-bromo-4-[(4-methoxyphenyl)methoxy]-1-nitrobenzene |
| InChIKey | GUDZGDDGZLKVBN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC(=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)