Products 1451254-94-6
CAS 1451254-94-6 is the registry number for 4-Carboxy-1-(4-carboxybenzyl)pyridin-1-ium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[(4-carboxyphenyl)methyl]pyridin-1-ium-4-carboxylic acid bromide (CAS 1451254-94-6) is a chemical compound with the molecular formula C14H12BrNO4 and a molecular weight of 338.15 g/mol. IUPAC name: 1-[(4-carboxyphenyl)methyl]pyridin-1-ium-4-carboxylic acid bromide. InChIKey: URSICNRWBFQXIX-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO4 |
|---|---|
| Molecular weight | 338.15 g/mol |
| IUPAC name | 1-[(4-carboxyphenyl)methyl]pyridin-1-ium-4-carboxylic acid bromide |
| InChIKey | URSICNRWBFQXIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C[N+]2=CC=C(C=C2)C(=O)O)C(=O)O.[Br-] |
Computed by PubChem (NCBI)