CAS 1513576-48-1 appears in our catalog under these names: 3-Bromo-5-(3-(furan-2-yl)propanamido)benzoic acid, 98%, 3-Bromo-5-(3-(furan-2-yl)propanamido)benzoic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25mg, 10mg.
3-bromo-5-[3-(furan-2-yl)propanoylamino]benzoic acid (CAS 1513576-48-1) is a chemical compound with the molecular formula C14H12BrNO4 and a molecular weight of 338.15 g/mol. IUPAC name: 3-bromo-5-[3-(furan-2-yl)propanoylamino]benzoic acid. InChIKey: WNCDKBRQUPIICF-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO4 |
|---|---|
| Molecular weight | 338.15 g/mol |
| IUPAC name | 3-bromo-5-[3-(furan-2-yl)propanoylamino]benzoic acid |
| InChIKey | WNCDKBRQUPIICF-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CCC(=O)NC2=CC(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)