cas: 3622-40-0 — see every product listed under this CAS number, including other names
2-Bromo-4-chlorobenzo[d]thiazole, 97% (CAS 3622-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F328954-100MG |
| cas | 3622-40-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 200.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-chloro-1,3-benzothiazole (CAS 3622-40-0) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-4-chloro-1,3-benzothiazole. InChIKey: OYBFKJFWVAZRMI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-4-chloro-1,3-benzothiazole |
| InChIKey | OYBFKJFWVAZRMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)Br |
Computed by PubChem (NCBI)