cas: 1784176-14-2 — see every product listed under this CAS number, including other names
2-Bromo-5-chloro-[1,2,4]triazolo[1,5-a]pyridine, 98% (CAS 1784176-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869973-100MG |
| cas | 1784176-14-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-chloro-[1,2,4]triazolo[1,5-a]pyridine (CAS 1784176-14-2) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 2-bromo-5-chloro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: YPOSNQBWLHQYDA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 2-bromo-5-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | YPOSNQBWLHQYDA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C(=C1)Cl)Br |
Computed by PubChem (NCBI)