CAS 1269667-51-7 appears in our catalog under these names: 7-Bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine, 95%, 7-Bromo-4-chloropyrrolo(2,1-f)(1,2,4)triazine, 97%, 7-Bromo-4-chloropyrrolo(2,1-f)(1,2,4)triazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
7-bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine (CAS 1269667-51-7) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 7-bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: WHHDFKYGOMDNGN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 7-bromo-4-chloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | WHHDFKYGOMDNGN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC=NN2C(=C1)Br)Cl |
Computed by PubChem (NCBI)