Products 143591-61-1
CAS 143591-61-1 appears in our catalog under these names: 3-Bromo-8-chloroimidazo[1,2-a]pyrazine, 98%, 3-Bromo-8-chloroimidazo[1,2-a]pyrazine 97%, Imidazo[1,2-a]pyrazine, 3-bromo-8-chloro-, 97%, 97%, 3-Bromo-8-chloroimidazo[1,2-a]pyrazine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg, 500g, 10g, 50g.
3-bromo-8-chloroimidazo[1,2-a]pyrazine (CAS 143591-61-1) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-8-chloroimidazo[1,2-a]pyrazine. InChIKey: MCEGPQSPRNOFMG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-8-chloroimidazo[1,2-a]pyrazine |
| InChIKey | MCEGPQSPRNOFMG-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=N1)Cl)Br |
Computed by PubChem (NCBI)