cas: 1256820-00-4 — see every product listed under this CAS number, including other names
2-Bromo-5-chloro-3-(trifluoromethyl)pyridine 98% (CAS 1256820-00-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331543-10g |
| cas | 1256820-00-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1560.75 Pln | |
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1004.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A331543 |
2-bromo-5-chloro-3-(trifluoromethyl)pyridine (CAS 1256820-00-4) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 2-bromo-5-chloro-3-(trifluoromethyl)pyridine. InChIKey: GDQVCXJOIDBNRP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 2-bromo-5-chloro-3-(trifluoromethyl)pyridine |
| InChIKey | GDQVCXJOIDBNRP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)