cas: 1256820-00-4 — see every product listed under this CAS number, including other names
2-Bromo-5-chloro-3-(trifluoromethyl)pyridine, 98%, 98% (CAS 1256820-00-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OGC-10g |
| cas | 1256820-00-4 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1288.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-5-chloro-3-(trifluoromethyl)pyridine (CAS 1256820-00-4) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 2-bromo-5-chloro-3-(trifluoromethyl)pyridine. InChIKey: GDQVCXJOIDBNRP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 2-bromo-5-chloro-3-(trifluoromethyl)pyridine |
| InChIKey | GDQVCXJOIDBNRP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)