cas: 1239463-37-6 — see every product listed under this CAS number, including other names
2-Bromo-5-fluoro-4-(trifluoromethyl)aniline 97% (CAS 1239463-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A309530-250mg |
| cas | 1239463-37-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A309530 |
2-bromo-5-fluoro-4-(trifluoromethyl)aniline (CAS 1239463-37-6) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 2-bromo-5-fluoro-4-(trifluoromethyl)aniline. InChIKey: HPYWKQKBKNKSDG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-(trifluoromethyl)aniline |
| InChIKey | HPYWKQKBKNKSDG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)N)F)C(F)(F)F |
Computed by PubChem (NCBI)