CAS 1239463-37-6 appears in our catalog under these names: 2-Bromo-5-fluoro-4-(trifluoromethyl)aniline, 95%, 2-Bromo-5-fluoro-4-(trifluoromethyl)aniline, 2-Bromo-5-fluoro-4-(trifluoromethyl)aniline 97%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 0,5g, 250mg.
2-bromo-5-fluoro-4-(trifluoromethyl)aniline (CAS 1239463-37-6) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 2-bromo-5-fluoro-4-(trifluoromethyl)aniline. InChIKey: HPYWKQKBKNKSDG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-(trifluoromethyl)aniline |
| InChIKey | HPYWKQKBKNKSDG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)N)F)C(F)(F)F |
Computed by PubChem (NCBI)