CAS 875664-46-3 appears in our catalog under these names: 4-Bromo-2-fluoro-6-(trifluoromethyl)aniline, 98%, 4-Bromo-2-fluoro-6-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 25g, 2g.
4-bromo-2-fluoro-6-(trifluoromethyl)aniline (CAS 875664-46-3) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 4-bromo-2-fluoro-6-(trifluoromethyl)aniline. InChIKey: FWIDRROZQFRPCM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-6-(trifluoromethyl)aniline |
| InChIKey | FWIDRROZQFRPCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)F)Br |
Computed by PubChem (NCBI)