2-Bromo-6-(bromomethyl)naphthalene, 95%
cas: 305798-02-1 — see every product listed under this CAS number, including other names
2-Bromo-6-(bromomethyl)naphthalene, 95% (CAS 305798-02-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A178855-250mg |
| cas | 305798-02-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 615.13 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1475.60 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 608.70 Pln | |
| BLDpharm | 5g | 1919.35 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 5g | 1835.83 Pln | |
| Fluorochem | 10g | 3153.07 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-6-(bromomethyl)naphthalene (CAS 305798-02-1) is a chemical compound with the molecular formula C11H8Br2 and a molecular weight of 299.99 g/mol. IUPAC name: 2-bromo-6-(bromomethyl)naphthalene. InChIKey: KNCXTOYNERTOJO-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2 |
|---|---|
| Molecular weight | 299.99 g/mol |
| IUPAC name | 2-bromo-6-(bromomethyl)naphthalene |
| InChIKey | KNCXTOYNERTOJO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1CBr |
Computed by PubChem (NCBI)
Synonyms:
2-bromo-6-(bromomethyl) naphthalene