Products 62415-75-2

CAS 62415-75-2 is the registry number for Naphthalene, 1,4-dibromo-2-methyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

1,4-dibromo-2-methylnaphthalene (CAS 62415-75-2) is a chemical compound with the molecular formula C11H8Br2 and a molecular weight of 299.99 g/mol. IUPAC name: 1,4-dibromo-2-methylnaphthalene. InChIKey: KXCQLIOBXCLMLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Br2
Molecular weight299.99 g/mol
IUPAC name1,4-dibromo-2-methylnaphthalene
InChIKeyKXCQLIOBXCLMLZ-UHFFFAOYSA-N
SMILESCC1=C(C2=CC=CC=C2C(=C1)Br)Br

Computed by PubChem (NCBI)