CAS 72758-17-9 is the registry number for 1-Bromo-8-(bromomethyl)naphthalene 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-8-(bromomethyl)naphthalene (CAS 72758-17-9) is a chemical compound with the molecular formula C11H8Br2 and a molecular weight of 299.99 g/mol. IUPAC name: 1-bromo-8-(bromomethyl)naphthalene. InChIKey: RUGOMNXLAWWDCF-UHFFFAOYSA-N.
| Molecular formula | C11H8Br2 |
|---|---|
| Molecular weight | 299.99 g/mol |
| IUPAC name | 1-bromo-8-(bromomethyl)naphthalene |
| InChIKey | RUGOMNXLAWWDCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CBr)C(=CC=C2)Br |
Computed by PubChem (NCBI)