2-Bromo-6-chlorobenzo[d]thiazole, 97%
cas: 3507-17-3 — see every product listed under this CAS number, including other names
2-Bromo-6-chlorobenzo[d]thiazole, 97% (CAS 3507-17-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-3056-10g |
| cas | 3507-17-3 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 513.38 Pln | |
| Fluorochem | 25g | 1101.71 Pln | |
| Fluorochem | 100g | 4137.10 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 693.00 Pln | |
| Ambeed | 25g | 1621.94 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 414.80 Pln | |
| Chemat | 25g | 885.20 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 10g | 741.99 Pln | |
| BLDpharm | 25g | 1741.63 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-bromo-6-chloro-1,3-benzothiazole (CAS 3507-17-3) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-6-chloro-1,3-benzothiazole. InChIKey: SWCKCAROSKGHBI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-6-chloro-1,3-benzothiazole |
| InChIKey | SWCKCAROSKGHBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)Br |
Computed by PubChem (NCBI)